C16H20F3NO2 — CID 136522526
1-(4-methoxyazepan-1-yl)-2-[2-(trifluoromethyl)phenyl]ethanone (PubChem CID 136522526) has the molecular formula C16H20F3NO2 and a molecular weight of 315.33 g/mol. Its IUPAC name is 1-(4-methoxyazepan-1-yl)-2-[2-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-(4-methoxyazepan-1-yl)-2-[2-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 136522526 |
| Molecular Formula | C16H20F3NO2 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 1-(4-methoxyazepan-1-yl)-2-[2-(trifluoromethyl)phenyl]ethanone |
| SMILES | COC1CCCN(C(=O)Cc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H20F3NO2/c1-22-13-6-4-9-20(10-8-13)15(21)11-12-5-2-3-7-14(12)16(17,18)19/h2-3,5,7,13H,4,6,8-11H2,1H3 |
| InChIKey | AHCWMBCWHGKPQU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |