C17H18F3N3O — CID 72842618
1-[4-(1H-imidazol-2-yl)piperidin-1-yl]-2-[2-(trifluoromethyl)phenyl]ethanone (PubChem CID 72842618) has the molecular formula C17H18F3N3O and a molecular weight of 337.35 g/mol. Its IUPAC name is 1-[4-(1H-imidazol-2-yl)piperidin-1-yl]-2-[2-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-[4-(1H-imidazol-2-yl)piperidin-1-yl]-2-[2-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 72842618 |
| Molecular Formula | C17H18F3N3O |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 1-[4-(1H-imidazol-2-yl)piperidin-1-yl]-2-[2-(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(Cc1ccccc1C(F)(F)F)N1CCC(c2ncc[nH]2)CC1 |
| InChI | InChI=1S/C17H18F3N3O/c18-17(19,20)14-4-2-1-3-13(14)11-15(24)23-9-5-12(6-10-23)16-21-7-8-22-16/h1-4,7-8,12H,5-6,9-11H2,(H,21,22) |
| InChIKey | LYFHGRPVQXRVRP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |