C20H20F3NO2 — CID 2728063
[4-(2-methoxyphenyl)piperidin-1-yl]-[2-(trifluoromethyl)phenyl]methanone (PubChem CID 2728063) has the molecular formula C20H20F3NO2 and a molecular weight of 363.38 g/mol. Its IUPAC name is [4-(2-methoxyphenyl)piperidin-1-yl]-[2-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-(2-methoxyphenyl)piperidin-1-yl]-[2-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 2728063 |
| Molecular Formula | C20H20F3NO2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | [4-(2-methoxyphenyl)piperidin-1-yl]-[2-(trifluoromethyl)phenyl]methanone |
| SMILES | COc1ccccc1C1CCN(C(=O)c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H20F3NO2/c1-26-18-9-5-3-6-15(18)14-10-12-24(13-11-14)19(25)16-7-2-4-8-17(16)20(21,22)23/h2-9,14H,10-13H2,1H3 |
| InChIKey | ZYHFQOYVFQLBDL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |