C13H13ClF3NO — CID 63391010
(4-chloropiperidin-1-yl)-[2-(trifluoromethyl)phenyl]methanone (PubChem CID 63391010) has the molecular formula C13H13ClF3NO and a molecular weight of 291.70 g/mol. Its IUPAC name is (4-chloropiperidin-1-yl)-[2-(trifluoromethyl)phenyl]methanone.
| Compound Name | (4-chloropiperidin-1-yl)-[2-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 63391010 |
| Molecular Formula | C13H13ClF3NO |
| Molecular Weight | 291.70 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | (4-chloropiperidin-1-yl)-[2-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccccc1C(F)(F)F)N1CCC(Cl)CC1 |
| InChI | InChI=1S/C13H13ClF3NO/c14-9-5-7-18(8-6-9)12(19)10-3-1-2-4-11(10)13(15,16)17/h1-4,9H,5-8H2 |
| InChIKey | SPHZRLWYAYTHPF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.70 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|