C15H17ClF3NO — CID 106838854
[4-(1-chloroethyl)piperidin-1-yl]-[2-(trifluoromethyl)phenyl]methanone (PubChem CID 106838854) has the molecular formula C15H17ClF3NO and a molecular weight of 319.75 g/mol. Its IUPAC name is [4-(1-chloroethyl)piperidin-1-yl]-[2-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-(1-chloroethyl)piperidin-1-yl]-[2-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 106838854 |
| Molecular Formula | C15H17ClF3NO |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | [4-(1-chloroethyl)piperidin-1-yl]-[2-(trifluoromethyl)phenyl]methanone |
| SMILES | CC(Cl)C1CCN(C(=O)c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H17ClF3NO/c1-10(16)11-6-8-20(9-7-11)14(21)12-4-2-3-5-13(12)15(17,18)19/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | HCLUFLMDGDBAOR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|