C22H27N3O2 — CID 134700249
[2-[4-(2-methoxyphenyl)piperidin-1-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone (PubChem CID 134700249) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is [2-[4-(2-methoxyphenyl)piperidin-1-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [2-[4-(2-methoxyphenyl)piperidin-1-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 134700249 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | [2-[4-(2-methoxyphenyl)piperidin-1-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone |
| SMILES | COc1ccccc1C1CCN(c2ncccc2C(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C22H27N3O2/c1-27-20-9-3-2-7-18(20)17-10-15-24(16-11-17)21-19(8-6-12-23-21)22(26)25-13-4-5-14-25/h2-3,6-9,12,17H,4-5,10-11,13-16H2,1H3 |
| InChIKey | JWEMODBNKLILFB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |