C23H27N3O4 — CID 91904267
[2-[1-(2-methoxybenzoyl)pyrrolidin-3-yl]oxy-3-pyridinyl]-piperidin-1-ylmethanone (PubChem CID 91904267) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is [2-[1-(2-methoxybenzoyl)pyrrolidin-3-yl]oxy-3-pyridinyl]-piperidin-1-ylmethanone.
| Compound Name | [2-[1-(2-methoxybenzoyl)pyrrolidin-3-yl]oxy-3-pyridinyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 91904267 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | [2-[1-(2-methoxybenzoyl)pyrrolidin-3-yl]oxy-3-pyridinyl]-piperidin-1-ylmethanone |
| SMILES | COc1ccccc1C(=O)N1CCC(Oc2ncccc2C(=O)N2CCCCC2)C1 |
| InChI | InChI=1S/C23H27N3O4/c1-29-20-10-4-3-8-18(20)22(27)26-15-11-17(16-26)30-21-19(9-7-12-24-21)23(28)25-13-5-2-6-14-25/h3-4,7-10,12,17H,2,5-6,11,13-16H2,1H3 |
| InChIKey | IGNIOTPZSLXSNW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |