C24H29N3O4 — CID 91913913
(4-ethoxyphenyl)-[3-[[3-(piperidine-1-carbonyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]methanone (PubChem CID 91913913) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is (4-ethoxyphenyl)-[3-[[3-(piperidine-1-carbonyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]methanone.
| Compound Name | (4-ethoxyphenyl)-[3-[[3-(piperidine-1-carbonyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 91913913 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | (4-ethoxyphenyl)-[3-[[3-(piperidine-1-carbonyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]methanone |
| SMILES | CCOc1ccc(C(=O)N2CCC(Oc3ncccc3C(=O)N3CCCCC3)C2)cc1 |
| InChI | InChI=1S/C24H29N3O4/c1-2-30-19-10-8-18(9-11-19)23(28)27-16-12-20(17-27)31-22-21(7-6-13-25-22)24(29)26-14-4-3-5-15-26/h6-11,13,20H,2-5,12,14-17H2,1H3 |
| InChIKey | QIBNCIBAZNSMOY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |