C30H28F6N2O2 — CID 147215754
1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-[4-[2-(2-methylphenyl)acetyl]piperazin-1-yl]phenyl]propan-2-one (PubChem CID 147215754) has the molecular formula C30H28F6N2O2 and a molecular weight of 562.55 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-[4-[2-(2-methylphenyl)acetyl]piperazin-1-yl]phenyl]propan-2-one.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-[4-[2-(2-methylphenyl)acetyl]piperazin-1-yl]phenyl]propan-2-one |
|---|---|
| PubChem CID | 147215754 |
| Molecular Formula | C30H28F6N2O2 |
| Molecular Weight | 562.55 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-[4-[2-(2-methylphenyl)acetyl]piperazin-1-yl]phenyl]propan-2-one |
| SMILES | Cc1ccccc1CC(=O)N1CCN(c2ccc(CC(=O)Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc2)CC1 |
| InChI | InChI=1S/C30H28F6N2O2/c1-20-4-2-3-5-23(20)18-28(40)38-12-10-37(11-13-38)26-8-6-21(7-9-26)16-27(39)17-22-14-24(29(31,32)33)19-25(15-22)30(34,35)36/h2-9,14-15,19H,10-13,16-18H2,1H3 |
| InChIKey | CGBSABYSJUGDFS-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.55 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|