C10H11ClN4S — CID 106811735
5-chloro-4-N-(1-thiophen-2-ylethyl)pyrimidine-4,6-diamine (PubChem CID 106811735) has the molecular formula C10H11ClN4S and a molecular weight of 254.75 g/mol. Its IUPAC name is 5-chloro-4-N-(1-thiophen-2-ylethyl)pyrimidine-4,6-diamine.
| Compound Name | 5-chloro-4-N-(1-thiophen-2-ylethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 106811735 |
| Molecular Formula | C10H11ClN4S |
| Molecular Weight | 254.75 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 5-chloro-4-N-(1-thiophen-2-ylethyl)pyrimidine-4,6-diamine |
| SMILES | CC(Nc1ncnc(N)c1Cl)c1cccs1 |
| InChI | InChI=1S/C10H11ClN4S/c1-6(7-3-2-4-16-7)15-10-8(11)9(12)13-5-14-10/h2-6H,1H3,(H3,12,13,14,15) |
| InChIKey | WOPLANRNTANIDO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.75 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |