C11H12BrN3S — CID 61227691
5-bromo-2-N-(1-thiophen-2-ylethyl)pyridine-2,3-diamine (PubChem CID 61227691) has the molecular formula C11H12BrN3S and a molecular weight of 298.21 g/mol. Its IUPAC name is 5-bromo-2-N-(1-thiophen-2-ylethyl)pyridine-2,3-diamine.
| Compound Name | 5-bromo-2-N-(1-thiophen-2-ylethyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 61227691 |
| Molecular Formula | C11H12BrN3S |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | 5-bromo-2-N-(1-thiophen-2-ylethyl)pyridine-2,3-diamine |
| SMILES | CC(Nc1ncc(Br)cc1N)c1cccs1 |
| InChI | InChI=1S/C11H12BrN3S/c1-7(10-3-2-4-16-10)15-11-9(13)5-8(12)6-14-11/h2-7H,13H2,1H3,(H,14,15) |
| InChIKey | UEJMDIZQFSJLTE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |