C10H12BrN5S — CID 80906692
5-bromo-2-hydrazinyl-N-(1-thiophen-2-ylethyl)pyrimidin-4-amine (PubChem CID 80906692) has the molecular formula C10H12BrN5S and a molecular weight of 314.21 g/mol. Its IUPAC name is 5-bromo-2-hydrazinyl-N-(1-thiophen-2-ylethyl)pyrimidin-4-amine.
| Compound Name | 5-bromo-2-hydrazinyl-N-(1-thiophen-2-ylethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80906692 |
| Molecular Formula | C10H12BrN5S |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | 5-bromo-2-hydrazinyl-N-(1-thiophen-2-ylethyl)pyrimidin-4-amine |
| SMILES | CC(Nc1nc(NN)ncc1Br)c1cccs1 |
| InChI | InChI=1S/C10H12BrN5S/c1-6(8-3-2-4-17-8)14-9-7(11)5-13-10(15-9)16-12/h2-6H,12H2,1H3,(H2,13,14,15,16) |
| InChIKey | KWSBPOMRNNFYIO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|