C9H16BrN5 — CID 80932768
5-bromo-2-hydrazinyl-N-pentan-2-ylpyrimidin-4-amine (PubChem CID 80932768) has the molecular formula C9H16BrN5 and a molecular weight of 274.17 g/mol. Its IUPAC name is 5-bromo-2-hydrazinyl-N-pentan-2-ylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-hydrazinyl-N-pentan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80932768 |
| Molecular Formula | C9H16BrN5 |
| Molecular Weight | 274.17 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 5-bromo-2-hydrazinyl-N-pentan-2-ylpyrimidin-4-amine |
| SMILES | CCCC(C)Nc1nc(NN)ncc1Br |
| InChI | InChI=1S/C9H16BrN5/c1-3-4-6(2)13-8-7(10)5-12-9(14-8)15-11/h5-6H,3-4,11H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | IUDNSBRDAMLFOZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.17 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|