C12H22BrN5 — CID 106026014
5-bromo-2-hydrazinyl-N-octan-4-ylpyrimidin-4-amine (PubChem CID 106026014) has the molecular formula C12H22BrN5 and a molecular weight of 316.25 g/mol. Its IUPAC name is 5-bromo-2-hydrazinyl-N-octan-4-ylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-hydrazinyl-N-octan-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 106026014 |
| Molecular Formula | C12H22BrN5 |
| Molecular Weight | 316.25 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 5-bromo-2-hydrazinyl-N-octan-4-ylpyrimidin-4-amine |
| SMILES | CCCCC(CCC)Nc1nc(NN)ncc1Br |
| InChI | InChI=1S/C12H22BrN5/c1-3-5-7-9(6-4-2)16-11-10(13)8-15-12(17-11)18-14/h8-9H,3-7,14H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | GQCOVBXOPOIYFR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.25 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|