C9H15BrN4O — CID 80911741
(5-bromo-4-pentoxypyrimidin-2-yl)hydrazine (PubChem CID 80911741) has the molecular formula C9H15BrN4O and a molecular weight of 275.15 g/mol. Its IUPAC name is (5-bromo-4-pentoxypyrimidin-2-yl)hydrazine.
| Compound Name | (5-bromo-4-pentoxypyrimidin-2-yl)hydrazine |
|---|---|
| PubChem CID | 80911741 |
| Molecular Formula | C9H15BrN4O |
| Molecular Weight | 275.15 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | (5-bromo-4-pentoxypyrimidin-2-yl)hydrazine |
| SMILES | CCCCCOc1nc(NN)ncc1Br |
| InChI | InChI=1S/C9H15BrN4O/c1-2-3-4-5-15-8-7(10)6-12-9(13-8)14-11/h6H,2-5,11H2,1H3,(H,12,13,14) |
| InChIKey | AMRDWENRNMWLDC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.15 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|