C10H17BrN4O3 — CID 103176581
[5-bromo-4-[2-(3-methoxypropoxy)ethoxy]pyrimidin-2-yl]hydrazine (PubChem CID 103176581) has the molecular formula C10H17BrN4O3 and a molecular weight of 321.18 g/mol. Its IUPAC name is [5-bromo-4-[2-(3-methoxypropoxy)ethoxy]pyrimidin-2-yl]hydrazine.
| Compound Name | [5-bromo-4-[2-(3-methoxypropoxy)ethoxy]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 103176581 |
| Molecular Formula | C10H17BrN4O3 |
| Molecular Weight | 321.18 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | [5-bromo-4-[2-(3-methoxypropoxy)ethoxy]pyrimidin-2-yl]hydrazine |
| SMILES | COCCCOCCOc1nc(NN)ncc1Br |
| InChI | InChI=1S/C10H17BrN4O3/c1-16-3-2-4-17-5-6-18-9-8(11)7-13-10(14-9)15-12/h7H,2-6,12H2,1H3,(H,13,14,15) |
| InChIKey | FBRBHVRGFZZYJM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.18 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|