C11H18N6O3 — CID 103408623
[4-[3-(2-methoxyethoxy)propoxy]-1H-pyrazolo[5,4-d]pyrimidin-6-yl]hydrazine (PubChem CID 103408623) has the molecular formula C11H18N6O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is [4-[3-(2-methoxyethoxy)propoxy]-1H-pyrazolo[5,4-d]pyrimidin-6-yl]hydrazine.
| Compound Name | [4-[3-(2-methoxyethoxy)propoxy]-1H-pyrazolo[5,4-d]pyrimidin-6-yl]hydrazine |
|---|---|
| PubChem CID | 103408623 |
| Molecular Formula | C11H18N6O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | [4-[3-(2-methoxyethoxy)propoxy]-1H-pyrazolo[5,4-d]pyrimidin-6-yl]hydrazine |
| SMILES | COCCOCCCOc1nc(NN)nc2[nH]ncc12 |
| InChI | InChI=1S/C11H18N6O3/c1-18-5-6-19-3-2-4-20-10-8-7-13-17-9(8)14-11(15-10)16-12/h7H,2-6,12H2,1H3,(H2,13,14,15,16,17) |
| InChIKey | KRNPIZPYNJKHPO-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 120.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|