C9H12N4O2S — CID 103336076
[4-(2-methoxyethoxy)thieno[2,3-d]pyrimidin-2-yl]hydrazine (PubChem CID 103336076) has the molecular formula C9H12N4O2S and a molecular weight of 240.29 g/mol. Its IUPAC name is [4-(2-methoxyethoxy)thieno[2,3-d]pyrimidin-2-yl]hydrazine.
| Compound Name | [4-(2-methoxyethoxy)thieno[2,3-d]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 103336076 |
| Molecular Formula | C9H12N4O2S |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | [4-(2-methoxyethoxy)thieno[2,3-d]pyrimidin-2-yl]hydrazine |
| SMILES | COCCOc1nc(NN)nc2sccc12 |
| InChI | InChI=1S/C9H12N4O2S/c1-14-3-4-15-7-6-2-5-16-8(6)12-9(11-7)13-10/h2,5H,3-4,10H2,1H3,(H,11,12,13) |
| InChIKey | WUTVVXUWOXDTLS-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|