C10H14N4OS — CID 103336122
(4-butoxythieno[2,3-d]pyrimidin-2-yl)hydrazine (PubChem CID 103336122) has the molecular formula C10H14N4OS and a molecular weight of 238.32 g/mol. Its IUPAC name is (4-butoxythieno[2,3-d]pyrimidin-2-yl)hydrazine.
| Compound Name | (4-butoxythieno[2,3-d]pyrimidin-2-yl)hydrazine |
|---|---|
| PubChem CID | 103336122 |
| Molecular Formula | C10H14N4OS |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | (4-butoxythieno[2,3-d]pyrimidin-2-yl)hydrazine |
| SMILES | CCCCOc1nc(NN)nc2sccc12 |
| InChI | InChI=1S/C10H14N4OS/c1-2-3-5-15-8-7-4-6-16-9(7)13-10(12-8)14-11/h4,6H,2-3,5,11H2,1H3,(H,12,13,14) |
| InChIKey | NNHPWHODIJAMTK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|