C10H13N3OS — CID 103331399
4-methoxy-N-propylthieno[2,3-d]pyrimidin-2-amine (PubChem CID 103331399) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is 4-methoxy-N-propylthieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-methoxy-N-propylthieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103331399 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 4-methoxy-N-propylthieno[2,3-d]pyrimidin-2-amine |
| SMILES | CCCNc1nc(OC)c2ccsc2n1 |
| InChI | InChI=1S/C10H13N3OS/c1-3-5-11-10-12-8(14-2)7-4-6-15-9(7)13-10/h4,6H,3,5H2,1-2H3,(H,11,12,13) |
| InChIKey | KCGMNTZSARBESO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |