C16H17N3OS — CID 103331849
4-(2-methylphenoxy)-N-propylthieno[2,3-d]pyrimidin-2-amine (PubChem CID 103331849) has the molecular formula C16H17N3OS and a molecular weight of 299.40 g/mol. Its IUPAC name is 4-(2-methylphenoxy)-N-propylthieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-(2-methylphenoxy)-N-propylthieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103331849 |
| Molecular Formula | C16H17N3OS |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 4-(2-methylphenoxy)-N-propylthieno[2,3-d]pyrimidin-2-amine |
| SMILES | CCCNc1nc(Oc2ccccc2C)c2ccsc2n1 |
| InChI | InChI=1S/C16H17N3OS/c1-3-9-17-16-18-14(12-8-10-21-15(12)19-16)20-13-7-5-4-6-11(13)2/h4-8,10H,3,9H2,1-2H3,(H,17,18,19) |
| InChIKey | GGZVAIHSJFWCPO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |