C15H14BrN3OS — CID 107287415
4-(5-bromo-2-methylphenoxy)-N-ethylthieno[2,3-d]pyrimidin-2-amine (PubChem CID 107287415) has the molecular formula C15H14BrN3OS and a molecular weight of 364.27 g/mol. Its IUPAC name is 4-(5-bromo-2-methylphenoxy)-N-ethylthieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-(5-bromo-2-methylphenoxy)-N-ethylthieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 107287415 |
| Molecular Formula | C15H14BrN3OS |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | 4-(5-bromo-2-methylphenoxy)-N-ethylthieno[2,3-d]pyrimidin-2-amine |
| SMILES | CCNc1nc(Oc2cc(Br)ccc2C)c2ccsc2n1 |
| InChI | InChI=1S/C15H14BrN3OS/c1-3-17-15-18-13(11-6-7-21-14(11)19-15)20-12-8-10(16)5-4-9(12)2/h4-8H,3H2,1-2H3,(H,17,18,19) |
| InChIKey | OLOOERIBINJZAN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |