C12H13F4N3OS — CID 103331237
N-propyl-4-(2,2,3,3-tetrafluoropropoxy)thieno[2,3-d]pyrimidin-2-amine (PubChem CID 103331237) has the molecular formula C12H13F4N3OS and a molecular weight of 323.32 g/mol. Its IUPAC name is N-propyl-4-(2,2,3,3-tetrafluoropropoxy)thieno[2,3-d]pyrimidin-2-amine.
| Compound Name | N-propyl-4-(2,2,3,3-tetrafluoropropoxy)thieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103331237 |
| Molecular Formula | C12H13F4N3OS |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | N-propyl-4-(2,2,3,3-tetrafluoropropoxy)thieno[2,3-d]pyrimidin-2-amine |
| SMILES | CCCNc1nc(OCC(F)(F)C(F)F)c2ccsc2n1 |
| InChI | InChI=1S/C12H13F4N3OS/c1-2-4-17-11-18-8(7-3-5-21-9(7)19-11)20-6-12(15,16)10(13)14/h3,5,10H,2,4,6H2,1H3,(H,17,18,19) |
| InChIKey | ZNDDPJJGJKQAIN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|