C11H12F4N4S — CID 106296189
2-N-ethyl-4-N-(2,2,3,3-tetrafluoropropyl)thieno[2,3-d]pyrimidine-2,4-diamine (PubChem CID 106296189) has the molecular formula C11H12F4N4S and a molecular weight of 308.30 g/mol. Its IUPAC name is 2-N-ethyl-4-N-(2,2,3,3-tetrafluoropropyl)thieno[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-ethyl-4-N-(2,2,3,3-tetrafluoropropyl)thieno[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 106296189 |
| Molecular Formula | C11H12F4N4S |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 2-N-ethyl-4-N-(2,2,3,3-tetrafluoropropyl)thieno[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CCNc1nc(NCC(F)(F)C(F)F)c2ccsc2n1 |
| InChI | InChI=1S/C11H12F4N4S/c1-2-16-10-18-7(6-3-4-20-8(6)19-10)17-5-11(14,15)9(12)13/h3-4,9H,2,5H2,1H3,(H2,16,17,18,19) |
| InChIKey | SPSISWUGLHMKFK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|