C12H17N5OS — CID 103325026
N-[2-[[2-(ethylamino)thieno[2,3-d]pyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 103325026) has the molecular formula C12H17N5OS and a molecular weight of 279.37 g/mol. Its IUPAC name is N-[2-[[2-(ethylamino)thieno[2,3-d]pyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[2-(ethylamino)thieno[2,3-d]pyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 103325026 |
| Molecular Formula | C12H17N5OS |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-[2-[[2-(ethylamino)thieno[2,3-d]pyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | CCNc1nc(NCCNC(C)=O)c2ccsc2n1 |
| InChI | InChI=1S/C12H17N5OS/c1-3-13-12-16-10(15-6-5-14-8(2)18)9-4-7-19-11(9)17-12/h4,7H,3,5-6H2,1-2H3,(H,14,18)(H2,13,15,16,17) |
| InChIKey | RJNIJZOUELOQPG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|