C12H18N4S — CID 103324250
4-N-butyl-2-N-ethylthieno[2,3-d]pyrimidine-2,4-diamine (PubChem CID 103324250) has the molecular formula C12H18N4S and a molecular weight of 250.37 g/mol. Its IUPAC name is 4-N-butyl-2-N-ethylthieno[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-2-N-ethylthieno[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 103324250 |
| Molecular Formula | C12H18N4S |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 4-N-butyl-2-N-ethylthieno[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CCCCNc1nc(NCC)nc2sccc12 |
| InChI | InChI=1S/C12H18N4S/c1-3-5-7-14-10-9-6-8-17-11(9)16-12(15-10)13-4-2/h6,8H,3-5,7H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | KMUIAPKITKERRC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|