C16H24N4S — CID 103328858
2-N-ethyl-4-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]thieno[2,3-d]pyrimidine-2,4-diamine (PubChem CID 103328858) has the molecular formula C16H24N4S and a molecular weight of 304.46 g/mol. Its IUPAC name is 2-N-ethyl-4-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]thieno[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-ethyl-4-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]thieno[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 103328858 |
| Molecular Formula | C16H24N4S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 2-N-ethyl-4-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]thieno[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CCNc1nc(NCC2C(C)(C)C2(C)C)c2ccsc2n1 |
| InChI | InChI=1S/C16H24N4S/c1-6-17-14-19-12(10-7-8-21-13(10)20-14)18-9-11-15(2,3)16(11,4)5/h7-8,11H,6,9H2,1-5H3,(H2,17,18,19,20) |
| InChIKey | MZLMZIHXICBHBB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |