C9H11BrF4N4 — CID 114169916
5-bromo-2-N-ethyl-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-2,4-diamine (PubChem CID 114169916) has the molecular formula C9H11BrF4N4 and a molecular weight of 331.11 g/mol. Its IUPAC name is 5-bromo-2-N-ethyl-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-2,4-diamine.
| Compound Name | 5-bromo-2-N-ethyl-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 114169916 |
| Molecular Formula | C9H11BrF4N4 |
| Molecular Weight | 331.11 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 5-bromo-2-N-ethyl-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-2,4-diamine |
| SMILES | CCNc1ncc(Br)c(NCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C9H11BrF4N4/c1-2-15-8-16-3-5(10)6(18-8)17-4-9(13,14)7(11)12/h3,7H,2,4H2,1H3,(H2,15,16,17,18) |
| InChIKey | MLELPDWJJKRKQJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.11 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|