C12H18N4OS — CID 103324825
2-[[2-(ethylamino)thieno[2,3-d]pyrimidin-4-yl]amino]butan-1-ol (PubChem CID 103324825) has the molecular formula C12H18N4OS and a molecular weight of 266.37 g/mol. Its IUPAC name is 2-[[2-(ethylamino)thieno[2,3-d]pyrimidin-4-yl]amino]butan-1-ol.
| Compound Name | 2-[[2-(ethylamino)thieno[2,3-d]pyrimidin-4-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 103324825 |
| Molecular Formula | C12H18N4OS |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2-[[2-(ethylamino)thieno[2,3-d]pyrimidin-4-yl]amino]butan-1-ol |
| SMILES | CCNc1nc(NC(CC)CO)c2ccsc2n1 |
| InChI | InChI=1S/C12H18N4OS/c1-3-8(7-17)14-10-9-5-6-18-11(9)16-12(15-10)13-4-2/h5-6,8,17H,3-4,7H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | PQKCPLKHNYMWSN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |