C10H8F5N3OS — CID 103333001
N-methyl-4-(2,2,3,3,3-pentafluoropropoxy)thieno[2,3-d]pyrimidin-2-amine (PubChem CID 103333001) has the molecular formula C10H8F5N3OS and a molecular weight of 313.25 g/mol. Its IUPAC name is N-methyl-4-(2,2,3,3,3-pentafluoropropoxy)thieno[2,3-d]pyrimidin-2-amine.
| Compound Name | N-methyl-4-(2,2,3,3,3-pentafluoropropoxy)thieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103333001 |
| Molecular Formula | C10H8F5N3OS |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | N-methyl-4-(2,2,3,3,3-pentafluoropropoxy)thieno[2,3-d]pyrimidin-2-amine |
| SMILES | CNc1nc(OCC(F)(F)C(F)(F)F)c2ccsc2n1 |
| InChI | InChI=1S/C10H8F5N3OS/c1-16-8-17-6(5-2-3-20-7(5)18-8)19-4-9(11,12)10(13,14)15/h2-3H,4H2,1H3,(H,16,17,18) |
| InChIKey | YGHNBICUYLWYKK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|