C10H11N3OS — CID 103331220
N-methyl-4-prop-2-enoxythieno[2,3-d]pyrimidin-2-amine (PubChem CID 103331220) has the molecular formula C10H11N3OS and a molecular weight of 221.28 g/mol. Its IUPAC name is N-methyl-4-prop-2-enoxythieno[2,3-d]pyrimidin-2-amine.
| Compound Name | N-methyl-4-prop-2-enoxythieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103331220 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | N-methyl-4-prop-2-enoxythieno[2,3-d]pyrimidin-2-amine |
| SMILES | C=CCOc1nc(NC)nc2sccc12 |
| InChI | InChI=1S/C10H11N3OS/c1-3-5-14-8-7-4-6-15-9(7)13-10(11-2)12-8/h3-4,6H,1,5H2,2H3,(H,11,12,13) |
| InChIKey | DPNSMVDFCHSONR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|