C13H9F2N3OS — CID 103332516
4-(2,3-difluorophenoxy)-N-methylthieno[2,3-d]pyrimidin-2-amine (PubChem CID 103332516) has the molecular formula C13H9F2N3OS and a molecular weight of 293.30 g/mol. Its IUPAC name is 4-(2,3-difluorophenoxy)-N-methylthieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-(2,3-difluorophenoxy)-N-methylthieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103332516 |
| Molecular Formula | C13H9F2N3OS |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 4-(2,3-difluorophenoxy)-N-methylthieno[2,3-d]pyrimidin-2-amine |
| SMILES | CNc1nc(Oc2cccc(F)c2F)c2ccsc2n1 |
| InChI | InChI=1S/C13H9F2N3OS/c1-16-13-17-11(7-5-6-20-12(7)18-13)19-9-4-2-3-8(14)10(9)15/h2-6H,1H3,(H,16,17,18) |
| InChIKey | ILWXZRXKZCIUOQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |