C12H6ClFN2OS — CID 103319903
2-chloro-4-(2-fluorophenoxy)thieno[2,3-d]pyrimidine (PubChem CID 103319903) has the molecular formula C12H6ClFN2OS and a molecular weight of 280.71 g/mol. Its IUPAC name is 2-chloro-4-(2-fluorophenoxy)thieno[2,3-d]pyrimidine.
| Compound Name | 2-chloro-4-(2-fluorophenoxy)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 103319903 |
| Molecular Formula | C12H6ClFN2OS |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 2-chloro-4-(2-fluorophenoxy)thieno[2,3-d]pyrimidine |
| SMILES | Fc1ccccc1Oc1nc(Cl)nc2sccc12 |
| InChI | InChI=1S/C12H6ClFN2OS/c13-12-15-10(7-5-6-18-11(7)16-12)17-9-4-2-1-3-8(9)14/h1-6H |
| InChIKey | WMRIOEKVCVBUJS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |