C14H11ClN2O3S — CID 103319866
2-chloro-4-(2,6-dimethoxyphenoxy)thieno[2,3-d]pyrimidine (PubChem CID 103319866) has the molecular formula C14H11ClN2O3S and a molecular weight of 322.77 g/mol. Its IUPAC name is 2-chloro-4-(2,6-dimethoxyphenoxy)thieno[2,3-d]pyrimidine.
| Compound Name | 2-chloro-4-(2,6-dimethoxyphenoxy)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 103319866 |
| Molecular Formula | C14H11ClN2O3S |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 2-chloro-4-(2,6-dimethoxyphenoxy)thieno[2,3-d]pyrimidine |
| SMILES | COc1cccc(OC)c1Oc1nc(Cl)nc2sccc12 |
| InChI | InChI=1S/C14H11ClN2O3S/c1-18-9-4-3-5-10(19-2)11(9)20-12-8-6-7-21-13(8)17-14(15)16-12/h3-7H,1-2H3 |
| InChIKey | JYDSLMPIRSPAQJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |