C8H7ClN2OS — CID 103319715
2-chloro-4-ethoxythieno[2,3-d]pyrimidine (PubChem CID 103319715) has the molecular formula C8H7ClN2OS and a molecular weight of 214.68 g/mol. Its IUPAC name is 2-chloro-4-ethoxythieno[2,3-d]pyrimidine.
| Compound Name | 2-chloro-4-ethoxythieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 103319715 |
| Molecular Formula | C8H7ClN2OS |
| Molecular Weight | 214.68 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 2-chloro-4-ethoxythieno[2,3-d]pyrimidine |
| SMILES | CCOc1nc(Cl)nc2sccc12 |
| InChI | InChI=1S/C8H7ClN2OS/c1-2-12-6-5-3-4-13-7(5)11-8(9)10-6/h3-4H,2H2,1H3 |
| InChIKey | WQYNBXPPYRVQMQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.68 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |