C12H16ClN3S — CID 103322599
2-chloro-N-(2-ethylbutyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103322599) has the molecular formula C12H16ClN3S and a molecular weight of 269.80 g/mol. Its IUPAC name is 2-chloro-N-(2-ethylbutyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-(2-ethylbutyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103322599 |
| Molecular Formula | C12H16ClN3S |
| Molecular Weight | 269.80 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2-chloro-N-(2-ethylbutyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCC(CC)CNc1nc(Cl)nc2sccc12 |
| InChI | InChI=1S/C12H16ClN3S/c1-3-8(4-2)7-14-10-9-5-6-17-11(9)16-12(13)15-10/h5-6,8H,3-4,7H2,1-2H3,(H,14,15,16) |
| InChIKey | ALHSVVCQZVQMMZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.80 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |