C10H11ClN4OS — CID 103320684
2-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-N-ethylacetamide (PubChem CID 103320684) has the molecular formula C10H11ClN4OS and a molecular weight of 270.75 g/mol. Its IUPAC name is 2-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-N-ethylacetamide.
| Compound Name | 2-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-N-ethylacetamide |
|---|---|
| PubChem CID | 103320684 |
| Molecular Formula | C10H11ClN4OS |
| Molecular Weight | 270.75 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 2-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-N-ethylacetamide |
| SMILES | CCNC(=O)CNc1nc(Cl)nc2sccc12 |
| InChI | InChI=1S/C10H11ClN4OS/c1-2-12-7(16)5-13-8-6-3-4-17-9(6)15-10(11)14-8/h3-4H,2,5H2,1H3,(H,12,16)(H,13,14,15) |
| InChIKey | DZEZKPYEHBBSSD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.75 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |