C13H18ClN3OS — CID 114145573
3-[[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]methyl]hexan-1-ol (PubChem CID 114145573) has the molecular formula C13H18ClN3OS and a molecular weight of 299.83 g/mol. Its IUPAC name is 3-[[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]methyl]hexan-1-ol.
| Compound Name | 3-[[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]methyl]hexan-1-ol |
|---|---|
| PubChem CID | 114145573 |
| Molecular Formula | C13H18ClN3OS |
| Molecular Weight | 299.83 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 3-[[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]methyl]hexan-1-ol |
| SMILES | CCCC(CCO)CNc1nc(Cl)nc2sccc12 |
| InChI | InChI=1S/C13H18ClN3OS/c1-2-3-9(4-6-18)8-15-11-10-5-7-19-12(10)17-13(14)16-11/h5,7,9,18H,2-4,6,8H2,1H3,(H,15,16,17) |
| InChIKey | HSFIQMCCDZLSQB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.83 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |