C11H17ClFN3O — CID 106116858
3-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]hexan-1-ol (PubChem CID 106116858) has the molecular formula C11H17ClFN3O and a molecular weight of 261.73 g/mol. Its IUPAC name is 3-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]hexan-1-ol.
| Compound Name | 3-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]hexan-1-ol |
|---|---|
| PubChem CID | 106116858 |
| Molecular Formula | C11H17ClFN3O |
| Molecular Weight | 261.73 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 3-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]hexan-1-ol |
| SMILES | CCCC(CCO)CNc1nc(Cl)ncc1F |
| InChI | InChI=1S/C11H17ClFN3O/c1-2-3-8(4-5-17)6-14-10-9(13)7-15-11(12)16-10/h7-8,17H,2-6H2,1H3,(H,14,15,16) |
| InChIKey | AWYMIJPLIJIMOD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.73 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |