C13H19ClN2O3 — CID 114145424
3-chloro-2-[2-(2-hydroxyethyl)pentylamino]pyridine-4-carboxylic acid (PubChem CID 114145424) has the molecular formula C13H19ClN2O3 and a molecular weight of 286.76 g/mol. Its IUPAC name is 3-chloro-2-[2-(2-hydroxyethyl)pentylamino]pyridine-4-carboxylic acid.
| Compound Name | 3-chloro-2-[2-(2-hydroxyethyl)pentylamino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114145424 |
| Molecular Formula | C13H19ClN2O3 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 3-chloro-2-[2-(2-hydroxyethyl)pentylamino]pyridine-4-carboxylic acid |
| SMILES | CCCC(CCO)CNc1nccc(C(=O)O)c1Cl |
| InChI | InChI=1S/C13H19ClN2O3/c1-2-3-9(5-7-17)8-16-12-11(14)10(13(18)19)4-6-15-12/h4,6,9,17H,2-3,5,7-8H2,1H3,(H,15,16)(H,18,19) |
| InChIKey | FXQWLXKMMBHLQV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |