C10H13ClN2O3 — CID 107062727
3-chloro-2-(3-hydroxybutylamino)pyridine-4-carboxylic acid (PubChem CID 107062727) has the molecular formula C10H13ClN2O3 and a molecular weight of 244.68 g/mol. Its IUPAC name is 3-chloro-2-(3-hydroxybutylamino)pyridine-4-carboxylic acid.
| Compound Name | 3-chloro-2-(3-hydroxybutylamino)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 107062727 |
| Molecular Formula | C10H13ClN2O3 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 3-chloro-2-(3-hydroxybutylamino)pyridine-4-carboxylic acid |
| SMILES | CC(O)CCNc1nccc(C(=O)O)c1Cl |
| InChI | InChI=1S/C10H13ClN2O3/c1-6(14)2-4-12-9-8(11)7(10(15)16)3-5-13-9/h3,5-6,14H,2,4H2,1H3,(H,12,13)(H,15,16) |
| InChIKey | JKJMGXGNASYKMQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |