C10H14ClN3O4S — CID 106342812
3-chloro-2-[2-(ethylsulfamoyl)ethylamino]pyridine-4-carboxylic acid (PubChem CID 106342812) has the molecular formula C10H14ClN3O4S and a molecular weight of 307.76 g/mol. Its IUPAC name is 3-chloro-2-[2-(ethylsulfamoyl)ethylamino]pyridine-4-carboxylic acid.
| Compound Name | 3-chloro-2-[2-(ethylsulfamoyl)ethylamino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 106342812 |
| Molecular Formula | C10H14ClN3O4S |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 3-chloro-2-[2-(ethylsulfamoyl)ethylamino]pyridine-4-carboxylic acid |
| SMILES | CCNS(=O)(=O)CCNc1nccc(C(=O)O)c1Cl |
| InChI | InChI=1S/C10H14ClN3O4S/c1-2-14-19(17,18)6-5-13-9-8(11)7(10(15)16)3-4-12-9/h3-4,14H,2,5-6H2,1H3,(H,12,13)(H,15,16) |
| InChIKey | YGPWPEIRJPCVLL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |