C12H20N4O4S — CID 106341966
ethyl 3-amino-2-[2-(ethylsulfamoyl)ethylamino]pyridine-4-carboxylate (PubChem CID 106341966) has the molecular formula C12H20N4O4S and a molecular weight of 316.38 g/mol. Its IUPAC name is ethyl 3-amino-2-[2-(ethylsulfamoyl)ethylamino]pyridine-4-carboxylate.
| Compound Name | ethyl 3-amino-2-[2-(ethylsulfamoyl)ethylamino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 106341966 |
| Molecular Formula | C12H20N4O4S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | ethyl 3-amino-2-[2-(ethylsulfamoyl)ethylamino]pyridine-4-carboxylate |
| SMILES | CCNS(=O)(=O)CCNc1nccc(C(=O)OCC)c1N |
| InChI | InChI=1S/C12H20N4O4S/c1-3-16-21(18,19)8-7-15-11-10(13)9(5-6-14-11)12(17)20-4-2/h5-6,16H,3-4,7-8,13H2,1-2H3,(H,14,15) |
| InChIKey | IAPSHEXMOUEANI-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |