C11H17N3O4S — CID 106337804
ethyl 2-[2-(methylsulfamoyl)ethylamino]pyridine-3-carboxylate (PubChem CID 106337804) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is ethyl 2-[2-(methylsulfamoyl)ethylamino]pyridine-3-carboxylate.
| Compound Name | ethyl 2-[2-(methylsulfamoyl)ethylamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 106337804 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | ethyl 2-[2-(methylsulfamoyl)ethylamino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1NCCS(=O)(=O)NC |
| InChI | InChI=1S/C11H17N3O4S/c1-3-18-11(15)9-5-4-6-13-10(9)14-7-8-19(16,17)12-2/h4-6,12H,3,7-8H2,1-2H3,(H,13,14) |
| InChIKey | WUBOMGALUNBYGQ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |