C13H20N2O2S — CID 113494066
ethyl 2-(3-methylsulfanylbutylamino)pyridine-3-carboxylate (PubChem CID 113494066) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is ethyl 2-(3-methylsulfanylbutylamino)pyridine-3-carboxylate.
| Compound Name | ethyl 2-(3-methylsulfanylbutylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 113494066 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | ethyl 2-(3-methylsulfanylbutylamino)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1NCCC(C)SC |
| InChI | InChI=1S/C13H20N2O2S/c1-4-17-13(16)11-6-5-8-14-12(11)15-9-7-10(2)18-3/h5-6,8,10H,4,7,9H2,1-3H3,(H,14,15) |
| InChIKey | VWHRFAWKBBYOKJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |