C13H20N2O3 — CID 104695551
ethyl 2-[(2-methoxy-2-methylpropyl)amino]pyridine-3-carboxylate (PubChem CID 104695551) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is ethyl 2-[(2-methoxy-2-methylpropyl)amino]pyridine-3-carboxylate.
| Compound Name | ethyl 2-[(2-methoxy-2-methylpropyl)amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 104695551 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | ethyl 2-[(2-methoxy-2-methylpropyl)amino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1NCC(C)(C)OC |
| InChI | InChI=1S/C13H20N2O3/c1-5-18-12(16)10-7-6-8-14-11(10)15-9-13(2,3)17-4/h6-8H,5,9H2,1-4H3,(H,14,15) |
| InChIKey | WXYAIPZPABCAFH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |