C12H17N3O2 — CID 113414922
ethyl 2-[[(E)-4-aminobut-2-enyl]amino]pyridine-3-carboxylate (PubChem CID 113414922) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is ethyl 2-[[(E)-4-aminobut-2-enyl]amino]pyridine-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-4-aminobut-2-enyl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 113414922 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | ethyl 2-[[(E)-4-aminobut-2-enyl]amino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1NC/C=C/CN |
| InChI | InChI=1S/C12H17N3O2/c1-2-17-12(16)10-6-5-9-15-11(10)14-8-4-3-7-13/h3-6,9H,2,7-8,13H2,1H3,(H,14,15)/b4-3+ |
| InChIKey | WGNYELXYBQOSDX-ONEGZZNKSA-N |
| XLogP | 1.19 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|