C13H18N2O2 — CID 43298774
ethyl 2-(cyclobutylmethylamino)pyridine-3-carboxylate (PubChem CID 43298774) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is ethyl 2-(cyclobutylmethylamino)pyridine-3-carboxylate.
| Compound Name | ethyl 2-(cyclobutylmethylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 43298774 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | ethyl 2-(cyclobutylmethylamino)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1NCC1CCC1 |
| InChI | InChI=1S/C13H18N2O2/c1-2-17-13(16)11-7-4-8-14-12(11)15-9-10-5-3-6-10/h4,7-8,10H,2-3,5-6,9H2,1H3,(H,14,15) |
| InChIKey | BCLKMKLRXNAEJO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |