C10H12F2N2O2 — CID 115407605
ethyl 2-(2,2-difluoroethylamino)pyridine-3-carboxylate (PubChem CID 115407605) has the molecular formula C10H12F2N2O2 and a molecular weight of 230.21 g/mol. Its IUPAC name is ethyl 2-(2,2-difluoroethylamino)pyridine-3-carboxylate.
| Compound Name | ethyl 2-(2,2-difluoroethylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 115407605 |
| Molecular Formula | C10H12F2N2O2 |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | ethyl 2-(2,2-difluoroethylamino)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1NCC(F)F |
| InChI | InChI=1S/C10H12F2N2O2/c1-2-16-10(15)7-4-3-5-13-9(7)14-6-8(11)12/h3-5,8H,2,6H2,1H3,(H,13,14) |
| InChIKey | LMMAWQJUNDZWLH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |