C14H20N2O2S — CID 104695484
ethyl 2-(thian-4-ylmethylamino)pyridine-3-carboxylate (PubChem CID 104695484) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is ethyl 2-(thian-4-ylmethylamino)pyridine-3-carboxylate.
| Compound Name | ethyl 2-(thian-4-ylmethylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 104695484 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | ethyl 2-(thian-4-ylmethylamino)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1NCC1CCSCC1 |
| InChI | InChI=1S/C14H20N2O2S/c1-2-18-14(17)12-4-3-7-15-13(12)16-10-11-5-8-19-9-6-11/h3-4,7,11H,2,5-6,8-10H2,1H3,(H,15,16) |
| InChIKey | JEJUBIMLPYDWOX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |